C19H23NO4S — CID 5245200
[(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2,4,6-trimethylbenzenesulfonate (PubChem CID 5245200) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 5245200 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2,4,6-trimethylbenzenesulfonate |
| SMILES | CC1=CC(=O)C(C(C)C)=CC1=NOS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C19H23NO4S/c1-11(2)16-10-17(13(4)9-18(16)21)20-24-25(22,23)19-14(5)7-12(3)8-15(19)6/h7-11H,1-6H3 |
| InChIKey | WWCOEPNBFCNCJQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|