About Polo-like Kinase Inhibitor V
Polo-like Kinase Inhibitor V (PubChem CID 5245203) has the molecular formula C18H19NO3
and a molecular weight of 297.30 g/mol. Its IUPAC name is [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2-methylbenzoate.
Molecular Properties
| Compound Name | Polo-like Kinase Inhibitor V |
| PubChem CID | 5245203 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2-methylbenzoate |
| SMILES | CC1=CC=CC=C1C(=O)ON=C2C=C(C(=O)C=C2C)C(C)C |
| InChI | InChI=1S/C18H19NO3/c1-11(2)15-10-16(13(4)9-17(15)20)19-22-18(21)14-8-6-5-7-12(14)3/h5-11H,1-4H3 |
| InChIKey | CMOJHDQJJPIVEC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | 555 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Polo-like Kinase Inhibitor V with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Polo-like Kinase Inhibitor V?
The IUPAC name of Polo-like Kinase Inhibitor V (CID 5245203) is [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 2-methylbenzoate.
What is the SMILES notation for Polo-like Kinase Inhibitor V?
The canonical SMILES for Polo-like Kinase Inhibitor V is CC1=CC=CC=C1C(=O)ON=C2C=C(C(=O)C=C2C)C(C)C.
What is the InChIKey of Polo-like Kinase Inhibitor V?
The InChIKey is CMOJHDQJJPIVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-11(2)15-10-16(13(4)9-17(15)20)19-22-18(21)14-8-6-5-7-12(14)3/h5-11H,1-4H3.
What are the key properties of Polo-like Kinase Inhibitor V?
Polo-like Kinase Inhibitor V has a molecular weight of 297.30 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Polo-like Kinase Inhibitor V is sourced from PubChem (CID 5245203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).