C27H24N2O5 — CID 5245271
methyl 6-(4-benzoyloxyphenyl)-3-benzyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 5245271) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is methyl 6-(4-benzoyloxyphenyl)-3-benzyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 6-(4-benzoyloxyphenyl)-3-benzyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 5245271 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | methyl 6-(4-benzoyloxyphenyl)-3-benzyl-4-methyl-2-oxo-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N(Cc2ccccc2)C(=O)NC1c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N2O5/c1-18-23(26(31)33-2)24(28-27(32)29(18)17-19-9-5-3-6-10-19)20-13-15-22(16-14-20)34-25(30)21-11-7-4-8-12-21/h3-16,24H,17H2,1-2H3,(H,28,32) |
| InChIKey | PVZQJSQJJCEWTA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|