About 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole
1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole (PubChem CID 5245492) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole |
| PubChem CID | 5245492 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(Cn2nc(C)cc2C)n1 |
| InChI | InChI=1S/C11H16N4/c1-8-5-10(3)14(12-8)7-15-11(4)6-9(2)13-15/h5-6H,7H2,1-4H3 |
| InChIKey | LGQXVRIHIPWAFZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole?
The IUPAC name of 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole (CID 5245492) is 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole.
What is the SMILES notation for 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole?
The canonical SMILES for 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole is Cc1cc(C)n(Cn2nc(C)cc2C)n1.
What is the InChIKey of 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole?
The InChIKey is LGQXVRIHIPWAFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-8-5-10(3)14(12-8)7-15-11(4)6-9(2)13-15/h5-6H,7H2,1-4H3.
What are the key properties of 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole?
1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole has a molecular weight of 204.28 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole is sourced from PubChem (CID 5245492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).