C11H16N4 — CID 5245630
1H-Pyrazole, 4,4'-methylenebis[3,5-dimethyl- (PubChem CID 5245630) has the molecular formula C11H16N4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3,5-dimethyl-1H-pyrazole.
| Compound Name | 1H-Pyrazole, 4,4'-methylenebis[3,5-dimethyl- |
|---|---|
| PubChem CID | 5245630 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | CC1=C(C(=NN1)C)CC2=C(NN=C2C)C |
| InChI | InChI=1S/C11H16N4/c1-6-10(7(2)13-12-6)5-11-8(3)14-15-9(11)4/h5H2,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | YCVRIOKURDSNRO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 199 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |