C7H14N3+ — CID 5245701
1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium (PubChem CID 5245701) has the molecular formula C7H14N3+ and a molecular weight of 140.21 g/mol. Its IUPAC name is 1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium.
| Compound Name | 1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium |
|---|---|
| PubChem CID | 5245701 |
| Molecular Formula | C7H14N3+ |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium |
| SMILES | C1CNC2=[N+](C1)CCCN2 |
| InChI | InChI=1S/C7H13N3/c1-3-8-7-9-4-2-6-10(7)5-1/h1-6H2,(H,8,9)/p+1 |
| InChIKey | FVKFHMNJTHKMRX-UHFFFAOYSA-O |
| XLogP | -0.66 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|