About 4-cyclopentylcyclohexene
4-cyclopentylcyclohexene (PubChem CID 524571) has the molecular formula C11H18
and a molecular weight of 150.27 g/mol. Its IUPAC name is 4-cyclopentylcyclohexene.
Molecular Properties
| Compound Name | 4-cyclopentylcyclohexene |
| PubChem CID | 524571 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 4-cyclopentylcyclohexene |
| SMILES | C1=CCC(C2CCCC2)CC1 |
| InChI | InChI=1S/C11H18/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-2,10-11H,3-9H2 |
| InChIKey | FCVDDRKYHZIJSH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopentylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopentylcyclohexene?
The IUPAC name of 4-cyclopentylcyclohexene (CID 524571) is 4-cyclopentylcyclohexene.
What is the SMILES notation for 4-cyclopentylcyclohexene?
The canonical SMILES for 4-cyclopentylcyclohexene is C1=CCC(C2CCCC2)CC1.
What is the InChIKey of 4-cyclopentylcyclohexene?
The InChIKey is FCVDDRKYHZIJSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-2,10-11H,3-9H2.
What are the key properties of 4-cyclopentylcyclohexene?
4-cyclopentylcyclohexene has a molecular weight of 150.27 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentylcyclohexene is sourced from PubChem (CID 524571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).