About 4-cyclohexylcyclohexene
4-cyclohexylcyclohexene (PubChem CID 524573) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 4-cyclohexylcyclohexene.
Molecular Properties
| Compound Name | 4-cyclohexylcyclohexene |
| PubChem CID | 524573 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 4-cyclohexylcyclohexene |
| SMILES | C1=CCC(C2CCCCC2)CC1 |
| InChI | InChI=1S/C12H20/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3,11-12H,2,4-10H2 |
| InChIKey | NHEQDCVKZARUJD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylcyclohexene?
The IUPAC name of 4-cyclohexylcyclohexene (CID 524573) is 4-cyclohexylcyclohexene.
What is the SMILES notation for 4-cyclohexylcyclohexene?
The canonical SMILES for 4-cyclohexylcyclohexene is C1=CCC(C2CCCCC2)CC1.
What is the InChIKey of 4-cyclohexylcyclohexene?
The InChIKey is NHEQDCVKZARUJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3,11-12H,2,4-10H2.
What are the key properties of 4-cyclohexylcyclohexene?
4-cyclohexylcyclohexene has a molecular weight of 164.29 g/mol, XLogP of 3.92, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylcyclohexene is sourced from PubChem (CID 524573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).