C8HF5 — CID 5245965
1-ethynyl-2,3,4,5,6-pentafluorobenzene (PubChem CID 5245965) has the molecular formula C8HF5 and a molecular weight of 192.09 g/mol. Its IUPAC name is 1-ethynyl-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-ethynyl-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 5245965 |
| Molecular Formula | C8HF5 |
| Molecular Weight | 192.09 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | 1-ethynyl-2,3,4,5,6-pentafluorobenzene |
| SMILES | C#Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8HF5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h1H |
| InChIKey | PBEXVWXHXPEARD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.09 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|