C15H9N5O2S — CID 5246093
9-(3-nitro-4-pyridinyl)-2-thia-5,9,12-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene (PubChem CID 5246093) has the molecular formula C15H9N5O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 9-(3-nitro-4-pyridinyl)-2-thia-5,9,12-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene.
| Compound Name | 9-(3-nitro-4-pyridinyl)-2-thia-5,9,12-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 5246093 |
| Molecular Formula | C15H9N5O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 9-(3-nitro-4-pyridinyl)-2-thia-5,9,12-triazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
| SMILES | O=[N+]([O-])c1cnccc1N1c2ccncc2Sc2ccncc21 |
| InChI | InChI=1S/C15H9N5O2S/c21-20(22)12-7-16-4-1-10(12)19-11-2-5-18-9-15(11)23-14-3-6-17-8-13(14)19/h1-9H |
| InChIKey | GSUUKQUBTBRWRM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|