C34H30N4O4 — CID 5246182
22,23-bis(4-methoxyphenyl)-1,10,12,21-tetrazahexacyclo[19.2.1.03,8.010,23.012,22.014,19]tetracosa-3,5,7,14,16,18-hexaene-11,24-dione (PubChem CID 5246182) has the molecular formula C34H30N4O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is 22,23-bis(4-methoxyphenyl)-1,10,12,21-tetrazahexacyclo[19.2.1.03,8.010,23.012,22.014,19]tetracosa-3,5,7,14,16,18-hexaene-11,24-dione.
| Compound Name | 22,23-bis(4-methoxyphenyl)-1,10,12,21-tetrazahexacyclo[19.2.1.03,8.010,23.012,22.014,19]tetracosa-3,5,7,14,16,18-hexaene-11,24-dione |
|---|---|
| PubChem CID | 5246182 |
| Molecular Formula | C34H30N4O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 22,23-bis(4-methoxyphenyl)-1,10,12,21-tetrazahexacyclo[19.2.1.03,8.010,23.012,22.014,19]tetracosa-3,5,7,14,16,18-hexaene-11,24-dione |
| SMILES | COc1ccc(C23N4Cc5ccccc5CN2C(=O)N2Cc5ccccc5CN(C4=O)C23c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H30N4O4/c1-41-29-15-11-27(12-16-29)33-34(28-13-17-30(42-2)18-14-28)37-21-25-9-5-6-10-26(25)22-38(34)32(40)36(33)20-24-8-4-3-7-23(24)19-35(33)31(37)39/h3-18H,19-22H2,1-2H3 |
| InChIKey | UMDYPYVEZOUHEM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |