C9H12N3O7P — CID 5246297
6-amino-3-(9-hydroxy-3-oxido-3-oxo-2,4,7-trioxa-3λ5-phosphabicyclo[4.2.1]nonan-8-yl)-1H-pyrimidin-3-ium-2-one (PubChem CID 5246297) has the molecular formula C9H12N3O7P and a molecular weight of 305.18 g/mol. Its IUPAC name is 6-amino-3-(9-hydroxy-3-oxido-3-oxo-2,4,7-trioxa-3λ5-phosphabicyclo[4.2.1]nonan-8-yl)-1H-pyrimidin-3-ium-2-one.
| Compound Name | 6-amino-3-(9-hydroxy-3-oxido-3-oxo-2,4,7-trioxa-3λ5-phosphabicyclo[4.2.1]nonan-8-yl)-1H-pyrimidin-3-ium-2-one |
|---|---|
| PubChem CID | 5246297 |
| Molecular Formula | C9H12N3O7P |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 6-amino-3-(9-hydroxy-3-oxido-3-oxo-2,4,7-trioxa-3λ5-phosphabicyclo[4.2.1]nonan-8-yl)-1H-pyrimidin-3-ium-2-one |
| SMILES | Nc1cc[n+](C2OC3COP(=O)([O-])OC2C3O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N3O7P/c10-5-1-2-12(9(14)11-5)8-7-6(13)4(18-8)3-17-20(15,16)19-7/h1-2,4,6-8,13H,3H2,(H3,10,11,14,15,16) |
| InChIKey | NKVPCRUXNCFYHE-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|