C12H22N2 — CID 5246377
1,2,3,4,4a,5,5a,6,7,8,9,9a,10,10a-tetradecahydrophenazine (PubChem CID 5246377) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1,2,3,4,4a,5,5a,6,7,8,9,9a,10,10a-tetradecahydrophenazine.
| Compound Name | 1,2,3,4,4a,5,5a,6,7,8,9,9a,10,10a-tetradecahydrophenazine |
|---|---|
| PubChem CID | 5246377 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1,2,3,4,4a,5,5a,6,7,8,9,9a,10,10a-tetradecahydrophenazine |
| SMILES | C1CCC2NC3CCCCC3NC2C1 |
| InChI | InChI=1S/C12H22N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h9-14H,1-8H2 |
| InChIKey | JPOVEXSHVNWPRM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |