About [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol
[6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol (PubChem CID 5246439) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol.
Molecular Properties
| Compound Name | [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol |
| PubChem CID | 5246439 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol |
| SMILES | OCC1=CC=CC(CO)N1 |
| InChI | InChI=1S/C7H11NO2/c9-4-6-2-1-3-7(5-10)8-6/h1-3,6,8-10H,4-5H2 |
| InChIKey | NASZUHIXPQHAPB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol?
The IUPAC name of [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol (CID 5246439) is [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol.
What is the SMILES notation for [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol?
The canonical SMILES for [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol is OCC1=CC=CC(CO)N1.
What is the InChIKey of [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol?
The InChIKey is NASZUHIXPQHAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c9-4-6-2-1-3-7(5-10)8-6/h1-3,6,8-10H,4-5H2.
What are the key properties of [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol?
[6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol has a molecular weight of 141.17 g/mol, XLogP of -0.62, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(hydroxymethyl)-1,2-dihydropyridin-2-yl]methanol is sourced from PubChem (CID 5246439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).