C11H25N11 — CID 5246723
6-[6-(4,6-diamino-1,3,5-triazinan-2-yl)-1,2-dihydropyridin-2-yl]-1,3,5-triazinane-2,4-diamine (PubChem CID 5246723) has the molecular formula C11H25N11 and a molecular weight of 311.40 g/mol. Its IUPAC name is 6-[6-(4,6-diamino-1,3,5-triazinan-2-yl)-1,2-dihydropyridin-2-yl]-1,3,5-triazinane-2,4-diamine.
| Compound Name | 6-[6-(4,6-diamino-1,3,5-triazinan-2-yl)-1,2-dihydropyridin-2-yl]-1,3,5-triazinane-2,4-diamine |
|---|---|
| PubChem CID | 5246723 |
| Molecular Formula | C11H25N11 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | 6-[6-(4,6-diamino-1,3,5-triazinan-2-yl)-1,2-dihydropyridin-2-yl]-1,3,5-triazinane-2,4-diamine |
| SMILES | NC1NC(N)NC(C2=CC=CC(C3NC(N)NC(N)N3)N2)N1 |
| InChI | InChI=1S/C11H25N11/c12-8-17-6(18-9(13)21-8)4-2-1-3-5(16-4)7-19-10(14)22-11(15)20-7/h1-4,6-11,16-22H,12-15H2 |
| InChIKey | HQVOUPCKVUGTHA-UHFFFAOYSA-N |
| XLogP | -5.42 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |