C8H14N2O3 — CID 5246737
1-(6-methyl-1,2,3,6-tetrahydropyridin-2-yl)-2-nitroethanol (PubChem CID 5246737) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(6-methyl-1,2,3,6-tetrahydropyridin-2-yl)-2-nitroethanol.
| Compound Name | 1-(6-methyl-1,2,3,6-tetrahydropyridin-2-yl)-2-nitroethanol |
|---|---|
| PubChem CID | 5246737 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(6-methyl-1,2,3,6-tetrahydropyridin-2-yl)-2-nitroethanol |
| SMILES | CC1C=CCC(C(O)C[N+](=O)[O-])N1 |
| InChI | InChI=1S/C8H14N2O3/c1-6-3-2-4-7(9-6)8(11)5-10(12)13/h2-3,6-9,11H,4-5H2,1H3 |
| InChIKey | XSHFYACTHTVNDP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|