About 3,4,5-trioxocyclopentene-1,2-diolate
3,4,5-trioxocyclopentene-1,2-diolate (PubChem CID 5246919) has the molecular formula C5O5-2
and a molecular weight of 140.05 g/mol. Its IUPAC name is 3,4,5-trioxocyclopentene-1,2-diolate.
Molecular Properties
| Compound Name | 3,4,5-trioxocyclopentene-1,2-diolate |
| PubChem CID | 5246919 |
| Molecular Formula | C5O5-2 |
| Molecular Weight | 140.05 g/mol |
| Exact Mass | 139.98 |
| IUPAC Name | 3,4,5-trioxocyclopentene-1,2-diolate |
| SMILES | O=c1c([O-])c([O-])c(=O)c1=O |
| InChI | InChI=1S/C5H2O5/c6-1-2(7)4(9)5(10)3(1)8/h6-7H/p-2 |
| InChIKey | RBSLJAJQOVYTRQ-UHFFFAOYSA-L |
| XLogP | -3.21 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.05 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-trioxocyclopentene-1,2-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trioxocyclopentene-1,2-diolate?
The IUPAC name of 3,4,5-trioxocyclopentene-1,2-diolate (CID 5246919) is 3,4,5-trioxocyclopentene-1,2-diolate.
What is the SMILES notation for 3,4,5-trioxocyclopentene-1,2-diolate?
The canonical SMILES for 3,4,5-trioxocyclopentene-1,2-diolate is O=c1c([O-])c([O-])c(=O)c1=O.
What is the InChIKey of 3,4,5-trioxocyclopentene-1,2-diolate?
The InChIKey is RBSLJAJQOVYTRQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H2O5/c6-1-2(7)4(9)5(10)3(1)8/h6-7H/p-2.
What are the key properties of 3,4,5-trioxocyclopentene-1,2-diolate?
3,4,5-trioxocyclopentene-1,2-diolate has a molecular weight of 140.05 g/mol, XLogP of -3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trioxocyclopentene-1,2-diolate is sourced from PubChem (CID 5246919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).