C13H11NO2S3 — CID 5246968
3-[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-3-yl]sulfanylpropanenitrile (PubChem CID 5246968) has the molecular formula C13H11NO2S3 and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-3-yl]sulfanylpropanenitrile.
| Compound Name | 3-[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-3-yl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 5246968 |
| Molecular Formula | C13H11NO2S3 |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 3-[2-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)thiophen-3-yl]sulfanylpropanenitrile |
| SMILES | N#CCCSc1ccsc1-c1scc2c1OCCO2 |
| InChI | InChI=1S/C13H11NO2S3/c14-3-1-6-17-10-2-7-18-12(10)13-11-9(8-19-13)15-4-5-16-11/h2,7-8H,1,4-6H2 |
| InChIKey | YMLNOKUADNYVLB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|