About N-butylcarbamate
N-butylcarbamate (PubChem CID 5247103) has the molecular formula C5H10NO2-
and a molecular weight of 116.14 g/mol. Its IUPAC name is N-butylcarbamate.
Molecular Properties
| Compound Name | N-butylcarbamate |
| PubChem CID | 5247103 |
| Molecular Formula | C5H10NO2- |
| Molecular Weight | 116.14 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | N-butylcarbamate |
| SMILES | CCCCNC(=O)[O-] |
| InChI | InChI=1S/C5H11NO2/c1-2-3-4-6-5(7)8/h6H,2-4H2,1H3,(H,7,8)/p-1 |
| InChIKey | ZZHGIUCYKGFIPV-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylcarbamate?
The IUPAC name of N-butylcarbamate (CID 5247103) is N-butylcarbamate.
What is the SMILES notation for N-butylcarbamate?
The canonical SMILES for N-butylcarbamate is CCCCNC(=O)[O-].
What is the InChIKey of N-butylcarbamate?
The InChIKey is ZZHGIUCYKGFIPV-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H11NO2/c1-2-3-4-6-5(7)8/h6H,2-4H2,1H3,(H,7,8)/p-1.
What are the key properties of N-butylcarbamate?
N-butylcarbamate has a molecular weight of 116.14 g/mol, XLogP of -0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylcarbamate is sourced from PubChem (CID 5247103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).