C41H22F6S2 — CID 5247240
3-[3,3,4,4,5,5-hexafluoro-2-[5-phenyl-2-(2-phenylethynyl)thiophen-3-yl]cyclopenten-1-yl]-5-phenyl-2-(2-phenylethynyl)thiophene (PubChem CID 5247240) has the molecular formula C41H22F6S2 and a molecular weight of 692.75 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[5-phenyl-2-(2-phenylethynyl)thiophen-3-yl]cyclopenten-1-yl]-5-phenyl-2-(2-phenylethynyl)thiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-phenyl-2-(2-phenylethynyl)thiophen-3-yl]cyclopenten-1-yl]-5-phenyl-2-(2-phenylethynyl)thiophene |
|---|---|
| PubChem CID | 5247240 |
| Molecular Formula | C41H22F6S2 |
| Molecular Weight | 692.75 g/mol |
| Exact Mass | 692.11 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-phenyl-2-(2-phenylethynyl)thiophen-3-yl]cyclopenten-1-yl]-5-phenyl-2-(2-phenylethynyl)thiophene |
| SMILES | FC1(F)C(c2cc(-c3ccccc3)sc2C#Cc2ccccc2)=C(c2cc(-c3ccccc3)sc2C#Cc2ccccc2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C41H22F6S2/c42-39(43)37(31-25-35(29-17-9-3-10-18-29)48-33(31)23-21-27-13-5-1-6-14-27)38(40(44,45)41(39,46)47)32-26-36(30-19-11-4-12-20-30)49-34(32)24-22-28-15-7-2-8-16-28/h1-20,25-26H |
| InChIKey | YIDDKKGCFBUDSD-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.75 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|