About 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene
6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene (PubChem CID 5247297) has the molecular formula C12H16OS2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene.
Molecular Properties
| Compound Name | 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene |
| PubChem CID | 5247297 |
| Molecular Formula | C12H16OS2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene |
| SMILES | c1cc2ccc1CSCCOCCSC2 |
| InChI | InChI=1S/C12H16OS2/c1-2-12-4-3-11(1)9-14-7-5-13-6-8-15-10-12/h1-4H,5-10H2 |
| InChIKey | HSYMRWHVGYWQSE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene?
The IUPAC name of 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene (CID 5247297) is 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene.
What is the SMILES notation for 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene?
The canonical SMILES for 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene is c1cc2ccc1CSCCOCCSC2.
What is the InChIKey of 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene?
The InChIKey is HSYMRWHVGYWQSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS2/c1-2-12-4-3-11(1)9-14-7-5-13-6-8-15-10-12/h1-4H,5-10H2.
What are the key properties of 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene?
6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene has a molecular weight of 240.39 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxa-3,9-dithiabicyclo[9.2.2]pentadeca-1(13),11,14-triene is sourced from PubChem (CID 5247297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).