About cobalt(3+);bis(4-methylbenzene-1,2-dithiolate)
cobalt(3+);bis(4-methylbenzene-1,2-dithiolate) (PubChem CID 5247358) has the molecular formula C14H12CoS4-
and a molecular weight of 367.45 g/mol. Its IUPAC name is cobalt(3+);bis(4-methylbenzene-1,2-dithiolate).
Molecular Properties
| Compound Name | cobalt(3+);bis(4-methylbenzene-1,2-dithiolate) |
| PubChem CID | 5247358 |
| Molecular Formula | C14H12CoS4- |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 366.92 |
| IUPAC Name | cobalt(3+);bis(4-methylbenzene-1,2-dithiolate) |
| SMILES | Cc1ccc([S-])c([S-])c1.Cc1ccc([S-])c([S-])c1.[Co+3] |
| InChI | InChI=1S/2C7H8S2.Co/c2*1-5-2-3-6(8)7(9)4-5;/h2*2-4,8-9H,1H3;/q;;+3/p-4 |
| InChIKey | MFDQGKMGIOBVRA-UHFFFAOYSA-J |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt(3+);bis(4-methylbenzene-1,2-dithiolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(3+);bis(4-methylbenzene-1,2-dithiolate)?
The IUPAC name of cobalt(3+);bis(4-methylbenzene-1,2-dithiolate) (CID 5247358) is cobalt(3+);bis(4-methylbenzene-1,2-dithiolate).
What is the SMILES notation for cobalt(3+);bis(4-methylbenzene-1,2-dithiolate)?
The canonical SMILES for cobalt(3+);bis(4-methylbenzene-1,2-dithiolate) is Cc1ccc([S-])c([S-])c1.Cc1ccc([S-])c([S-])c1.[Co+3].
What is the InChIKey of cobalt(3+);bis(4-methylbenzene-1,2-dithiolate)?
The InChIKey is MFDQGKMGIOBVRA-UHFFFAOYSA-J. The full InChI is InChI=1S/2C7H8S2.Co/c2*1-5-2-3-6(8)7(9)4-5;/h2*2-4,8-9H,1H3;/q;;+3/p-4.
What are the key properties of cobalt(3+);bis(4-methylbenzene-1,2-dithiolate)?
cobalt(3+);bis(4-methylbenzene-1,2-dithiolate) has a molecular weight of 367.45 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(3+);bis(4-methylbenzene-1,2-dithiolate) is sourced from PubChem (CID 5247358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).