About 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole
1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole (PubChem CID 5247402) has the molecular formula C21H26N2
and a molecular weight of 306.45 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole.
Molecular Properties
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole |
| PubChem CID | 5247402 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)C2)c(C)c1 |
| InChI | InChI=1S/C21H26N2/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6/h7-12H,13H2,1-6H3 |
| InChIKey | RSTLYZXJMXWXEI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole?
The IUPAC name of 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole (CID 5247402) is 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole.
What is the SMILES notation for 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole?
The canonical SMILES for 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole is Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)C2)c(C)c1.
What is the InChIKey of 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole?
The InChIKey is RSTLYZXJMXWXEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6/h7-12H,13H2,1-6H3.
What are the key properties of 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole?
1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole has a molecular weight of 306.45 g/mol, XLogP of 5.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazole is sourced from PubChem (CID 5247402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).