C15H24N2O3 — CID 5247543
6-hydroxy-6-(2-oxopropyl)-1,2,3,4,4a,6a,7,8,9,10,10a,10b-dodecahydro-1,10-phenanthrolin-5-one (PubChem CID 5247543) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 6-hydroxy-6-(2-oxopropyl)-1,2,3,4,4a,6a,7,8,9,10,10a,10b-dodecahydro-1,10-phenanthrolin-5-one.
| Compound Name | 6-hydroxy-6-(2-oxopropyl)-1,2,3,4,4a,6a,7,8,9,10,10a,10b-dodecahydro-1,10-phenanthrolin-5-one |
|---|---|
| PubChem CID | 5247543 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 6-hydroxy-6-(2-oxopropyl)-1,2,3,4,4a,6a,7,8,9,10,10a,10b-dodecahydro-1,10-phenanthrolin-5-one |
| SMILES | CC(=O)CC1(O)C(=O)C2CCCNC2C2NCCCC21 |
| InChI | InChI=1S/C15H24N2O3/c1-9(18)8-15(20)11-5-3-7-17-13(11)12-10(14(15)19)4-2-6-16-12/h10-13,16-17,20H,2-8H2,1H3 |
| InChIKey | MEJKVGARRSQCFY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |