C12AuCl10-2 — CID 5247781
gold;bis(1,2,3,4,5-pentachlorobenzene-6-ide) (PubChem CID 5247781) has the molecular formula C12AuCl10-2 and a molecular weight of 695.63 g/mol. Its IUPAC name is gold;bis(1,2,3,4,5-pentachlorobenzene-6-ide).
| Compound Name | gold;bis(1,2,3,4,5-pentachlorobenzene-6-ide) |
|---|---|
| PubChem CID | 5247781 |
| Molecular Formula | C12AuCl10-2 |
| Molecular Weight | 695.63 g/mol |
| Exact Mass | 690.66 |
| IUPAC Name | gold;bis(1,2,3,4,5-pentachlorobenzene-6-ide) |
| SMILES | Clc1[c-]c(Cl)c(Cl)c(Cl)c1Cl.Clc1[c-]c(Cl)c(Cl)c(Cl)c1Cl.[Au] |
| InChI | InChI=1S/2C6Cl5.Au/c2*7-2-1-3(8)5(10)6(11)4(2)9;/q2*-1; |
| InChIKey | DPGQNVQVBSNKLJ-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.63 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|