C26H40N2 — CID 5248041
N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diamine (PubChem CID 5248041) has the molecular formula C26H40N2 and a molecular weight of 380.62 g/mol. Its IUPAC name is N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 5248041 |
| Molecular Formula | C26H40N2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diamine |
| SMILES | CC(C)c1cccc(C(C)C)c1NCCNc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C26H40N2/c1-17(2)21-11-9-12-22(18(3)4)25(21)27-15-16-28-26-23(19(5)6)13-10-14-24(26)20(7)8/h9-14,17-20,27-28H,15-16H2,1-8H3 |
| InChIKey | RVMDHNMIJJBYQG-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|