About naphthalene-1,8-dithiol
naphthalene-1,8-dithiol (PubChem CID 5248108) has the molecular formula C10H8S2
and a molecular weight of 192.31 g/mol. Its IUPAC name is naphthalene-1,8-dithiol.
Molecular Properties
| Compound Name | naphthalene-1,8-dithiol |
| PubChem CID | 5248108 |
| Molecular Formula | C10H8S2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | naphthalene-1,8-dithiol |
| SMILES | Sc1cccc2cccc(S)c12 |
| InChI | InChI=1S/C10H8S2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6,11-12H |
| InChIKey | GMHNWMFGZBBHPP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1,8-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,8-dithiol?
The IUPAC name of naphthalene-1,8-dithiol (CID 5248108) is naphthalene-1,8-dithiol.
What is the SMILES notation for naphthalene-1,8-dithiol?
The canonical SMILES for naphthalene-1,8-dithiol is Sc1cccc2cccc(S)c12.
What is the InChIKey of naphthalene-1,8-dithiol?
The InChIKey is GMHNWMFGZBBHPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8S2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6,11-12H.
What are the key properties of naphthalene-1,8-dithiol?
naphthalene-1,8-dithiol has a molecular weight of 192.31 g/mol, XLogP of 3.42, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,8-dithiol is sourced from PubChem (CID 5248108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).