About 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc
2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc (PubChem CID 5248117) has the molecular formula C13H14Cl2N5Zn-
and a molecular weight of 376.59 g/mol. Its IUPAC name is 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc.
Molecular Properties
| Compound Name | 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc |
| PubChem CID | 5248117 |
| Molecular Formula | C13H14Cl2N5Zn- |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc |
| SMILES | C1=CC(Cn2cccn2)[N-]C(Cn2cccn2)=C1.Cl[Zn]Cl |
| InChI | InChI=1S/C13H14N5.2ClH.Zn/c1-4-12(10-17-8-2-6-14-17)16-13(5-1)11-18-9-3-7-15-18;;;/h1-9,12H,10-11H2;2*1H;/q-1;;;+2/p-2 |
| InChIKey | YWLCGDPXPOFZMC-UHFFFAOYSA-L |
| XLogP | 3.35 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc?
The IUPAC name of 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc (CID 5248117) is 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc.
What is the SMILES notation for 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc?
The canonical SMILES for 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc is C1=CC(Cn2cccn2)[N-]C(Cn2cccn2)=C1.Cl[Zn]Cl.
What is the InChIKey of 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc?
The InChIKey is YWLCGDPXPOFZMC-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H14N5.2ClH.Zn/c1-4-12(10-17-8-2-6-14-17)16-13(5-1)11-18-9-3-7-15-18;;;/h1-9,12H,10-11H2;2*1H;/q-1;;;+2/p-2.
What are the key properties of 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc?
2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc has a molecular weight of 376.59 g/mol, XLogP of 3.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(pyrazol-1-ylmethyl)-2H-pyridin-1-ide;dichlorozinc is sourced from PubChem (CID 5248117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).