C16H14N4O — CID 5248167
1-(3,6-diphenyl-1H-1,2,4,5-tetrazin-2-yl)ethanone (PubChem CID 5248167) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-(3,6-diphenyl-1H-1,2,4,5-tetrazin-2-yl)ethanone.
| Compound Name | 1-(3,6-diphenyl-1H-1,2,4,5-tetrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 5248167 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-(3,6-diphenyl-1H-1,2,4,5-tetrazin-2-yl)ethanone |
| SMILES | CC(=O)N1NC(c2ccccc2)=NN=C1c1ccccc1 |
| InChI | InChI=1S/C16H14N4O/c1-12(21)20-16(14-10-6-3-7-11-14)18-17-15(19-20)13-8-4-2-5-9-13/h2-11H,1H3,(H,17,19) |
| InChIKey | IWGHDZZOQHYEID-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |