About 3-formyloxybutyl formate
3-formyloxybutyl formate (PubChem CID 524828) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 3-formyloxybutyl formate.
Molecular Properties
| Compound Name | 3-formyloxybutyl formate |
| PubChem CID | 524828 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 3-formyloxybutyl formate |
| SMILES | CC(CCOC=O)OC=O |
| InChI | InChI=1S/C6H10O4/c1-6(10-5-8)2-3-9-4-7/h4-6H,2-3H2,1H3 |
| InChIKey | AAEDMUBUSKPAOR-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-formyloxybutyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-formyloxybutyl formate?
The IUPAC name of 3-formyloxybutyl formate (CID 524828) is 3-formyloxybutyl formate.
What is the SMILES notation for 3-formyloxybutyl formate?
The canonical SMILES for 3-formyloxybutyl formate is CC(CCOC=O)OC=O.
What is the InChIKey of 3-formyloxybutyl formate?
The InChIKey is AAEDMUBUSKPAOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-6(10-5-8)2-3-9-4-7/h4-6H,2-3H2,1H3.
What are the key properties of 3-formyloxybutyl formate?
3-formyloxybutyl formate has a molecular weight of 146.14 g/mol, XLogP of 0.11, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-formyloxybutyl formate is sourced from PubChem (CID 524828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).