C21H24 — CID 5248496
4,4-dimethyl-9-phenyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]naphthalene (PubChem CID 5248496) has the molecular formula C21H24 and a molecular weight of 276.42 g/mol. Its IUPAC name is 4,4-dimethyl-9-phenyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]naphthalene.
| Compound Name | 4,4-dimethyl-9-phenyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]naphthalene |
|---|---|
| PubChem CID | 5248496 |
| Molecular Formula | C21H24 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 4,4-dimethyl-9-phenyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]naphthalene |
| SMILES | CC1(C)c2ccccc2C(c2ccccc2)C2CCCC21 |
| InChI | InChI=1S/C21H24/c1-21(2)18-13-7-6-11-16(18)20(15-9-4-3-5-10-15)17-12-8-14-19(17)21/h3-7,9-11,13,17,19-20H,8,12,14H2,1-2H3 |
| InChIKey | UFFVURZSJYNVOM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |