About 1,5-dimethoxy-2,3-dimethylbenzene
1,5-dimethoxy-2,3-dimethylbenzene (PubChem CID 524858) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1,5-dimethoxy-2,3-dimethylbenzene.
Molecular Properties
| Compound Name | 1,5-dimethoxy-2,3-dimethylbenzene |
| PubChem CID | 524858 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1,5-dimethoxy-2,3-dimethylbenzene |
| SMILES | COc1cc(C)c(C)c(OC)c1 |
| InChI | InChI=1S/C10H14O2/c1-7-5-9(11-3)6-10(12-4)8(7)2/h5-6H,1-4H3 |
| InChIKey | GAOOOWSRSMRHPB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethoxy-2,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethoxy-2,3-dimethylbenzene?
The IUPAC name of 1,5-dimethoxy-2,3-dimethylbenzene (CID 524858) is 1,5-dimethoxy-2,3-dimethylbenzene.
What is the SMILES notation for 1,5-dimethoxy-2,3-dimethylbenzene?
The canonical SMILES for 1,5-dimethoxy-2,3-dimethylbenzene is COc1cc(C)c(C)c(OC)c1.
What is the InChIKey of 1,5-dimethoxy-2,3-dimethylbenzene?
The InChIKey is GAOOOWSRSMRHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-7-5-9(11-3)6-10(12-4)8(7)2/h5-6H,1-4H3.
What are the key properties of 1,5-dimethoxy-2,3-dimethylbenzene?
1,5-dimethoxy-2,3-dimethylbenzene has a molecular weight of 166.22 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethoxy-2,3-dimethylbenzene is sourced from PubChem (CID 524858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).