About chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane
chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane (PubChem CID 5248663) has the molecular formula C27H45ClN6PZn+
and a molecular weight of 585.52 g/mol. Its IUPAC name is chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane.
Molecular Properties
| Compound Name | chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane |
| PubChem CID | 5248663 |
| Molecular Formula | C27H45ClN6PZn+ |
| Molecular Weight | 585.52 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane |
| SMILES | CC(C)c1nc(P(c2nc(C(C)C)c(C(C)C)[nH]2)c2nc(C(C)C)c(C(C)C)[nH]2)[nH]c1C(C)C.Cl[Zn+] |
| InChI | InChI=1S/C27H45N6P.ClH.Zn/c1-13(2)19-20(14(3)4)29-25(28-19)34(26-30-21(15(5)6)22(31-26)16(7)8)27-32-23(17(9)10)24(33-27)18(11)12;;/h13-18H,1-12H3,(H,28,29)(H,30,31)(H,32,33);1H;/q;;+2/p-1 |
| InChIKey | SUEPKDFSNYWICV-UHFFFAOYSA-M |
| XLogP | 7.04 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 585.52 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane?
The IUPAC name of chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane (CID 5248663) is chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane.
What is the SMILES notation for chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane?
The canonical SMILES for chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane is CC(C)c1nc(P(c2nc(C(C)C)c(C(C)C)[nH]2)c2nc(C(C)C)c(C(C)C)[nH]2)[nH]c1C(C)C.Cl[Zn+].
What is the InChIKey of chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane?
The InChIKey is SUEPKDFSNYWICV-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H45N6P.ClH.Zn/c1-13(2)19-20(14(3)4)29-25(28-19)34(26-30-21(15(5)6)22(31-26)16(7)8)27-32-23(17(9)10)24(33-27)18(11)12;;/h13-18H,1-12H3,(H,28,29)(H,30,31)(H,32,33);1H;/q;;+2/p-1.
What are the key properties of chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane?
chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane has a molecular weight of 585.52 g/mol, XLogP of 7.04, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chlorozinc(1+);tris[4,5-di(propan-2-yl)-1H-imidazol-2-yl]phosphane is sourced from PubChem (CID 5248663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).