About fluoren-8a-ide
fluoren-8a-ide (PubChem CID 5248810) has the molecular formula C13H9-
and a molecular weight of 165.21 g/mol. Its IUPAC name is fluoren-8a-ide.
Molecular Properties
| Compound Name | fluoren-8a-ide |
| PubChem CID | 5248810 |
| Molecular Formula | C13H9- |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | fluoren-8a-ide |
| SMILES | c1ccc2c(c1)c[c-]1ccccc21 |
| InChI | InChI=1S/C13H9/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-9H/q-1 |
| InChIKey | HBKSMXZETHGHQU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze fluoren-8a-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoren-8a-ide?
The IUPAC name of fluoren-8a-ide (CID 5248810) is fluoren-8a-ide.
What is the SMILES notation for fluoren-8a-ide?
The canonical SMILES for fluoren-8a-ide is c1ccc2c(c1)c[c-]1ccccc21.
What is the InChIKey of fluoren-8a-ide?
The InChIKey is HBKSMXZETHGHQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-9H/q-1.
What are the key properties of fluoren-8a-ide?
fluoren-8a-ide has a molecular weight of 165.21 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoren-8a-ide is sourced from PubChem (CID 5248810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).