About oxan-4-yl acetate
oxan-4-yl acetate (PubChem CID 524898) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is oxan-4-yl acetate.
Molecular Properties
| Compound Name | oxan-4-yl acetate |
| PubChem CID | 524898 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | oxan-4-yl acetate |
| SMILES | CC(=O)OC1CCOCC1 |
| InChI | InChI=1S/C7H12O3/c1-6(8)10-7-2-4-9-5-3-7/h7H,2-5H2,1H3 |
| InChIKey | JAROKJKPBZZIQN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxan-4-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl acetate?
The IUPAC name of oxan-4-yl acetate (CID 524898) is oxan-4-yl acetate.
What is the SMILES notation for oxan-4-yl acetate?
The canonical SMILES for oxan-4-yl acetate is CC(=O)OC1CCOCC1.
What is the InChIKey of oxan-4-yl acetate?
The InChIKey is JAROKJKPBZZIQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-6(8)10-7-2-4-9-5-3-7/h7H,2-5H2,1H3.
What are the key properties of oxan-4-yl acetate?
oxan-4-yl acetate has a molecular weight of 144.17 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl acetate is sourced from PubChem (CID 524898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).