About N'-(2-hydroxyethyl)oxamide
N'-(2-hydroxyethyl)oxamide (PubChem CID 5249043) has the molecular formula C4H8N2O3
and a molecular weight of 132.12 g/mol. Its IUPAC name is N'-(2-hydroxyethyl)oxamide.
Molecular Properties
| Compound Name | N'-(2-hydroxyethyl)oxamide |
| PubChem CID | 5249043 |
| Molecular Formula | C4H8N2O3 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | N'-(2-hydroxyethyl)oxamide |
| SMILES | NC(=O)C(=O)NCCO |
| InChI | InChI=1S/C4H8N2O3/c5-3(8)4(9)6-1-2-7/h7H,1-2H2,(H2,5,8)(H,6,9) |
| InChIKey | COVMBDWAODLWIB-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-hydroxyethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-hydroxyethyl)oxamide?
The IUPAC name of N'-(2-hydroxyethyl)oxamide (CID 5249043) is N'-(2-hydroxyethyl)oxamide.
What is the SMILES notation for N'-(2-hydroxyethyl)oxamide?
The canonical SMILES for N'-(2-hydroxyethyl)oxamide is NC(=O)C(=O)NCCO.
What is the InChIKey of N'-(2-hydroxyethyl)oxamide?
The InChIKey is COVMBDWAODLWIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O3/c5-3(8)4(9)6-1-2-7/h7H,1-2H2,(H2,5,8)(H,6,9).
What are the key properties of N'-(2-hydroxyethyl)oxamide?
N'-(2-hydroxyethyl)oxamide has a molecular weight of 132.12 g/mol, XLogP of -2.42, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-hydroxyethyl)oxamide is sourced from PubChem (CID 5249043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).