C25H42O2Si — CID 524944
17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 524944) has the molecular formula C25H42O2Si and a molecular weight of 402.70 g/mol. Its IUPAC name is 17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 524944 |
| Molecular Formula | C25H42O2Si |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 17-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C(O[Si](C)(C)C(C)(C)C)CCC12 |
| InChI | InChI=1S/C25H42O2Si/c1-23(2,3)28(6,7)27-22-11-10-20-19-9-8-17-16-18(26)12-14-24(17,4)21(19)13-15-25(20,22)5/h16,19-22H,8-15H2,1-7H3 |
| InChIKey | RSOSYYWFEQKUMW-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|