C13H18N2O4 — CID 524965
2-(2-oxopropanoyl)-3-propan-2-yl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 524965) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(2-oxopropanoyl)-3-propan-2-yl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-(2-oxopropanoyl)-3-propan-2-yl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 524965 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(2-oxopropanoyl)-3-propan-2-yl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | CC(=O)C(=O)N1C(=O)C2CCCN2C(=O)C1C(C)C |
| InChI | InChI=1S/C13H18N2O4/c1-7(2)10-13(19)14-6-4-5-9(14)12(18)15(10)11(17)8(3)16/h7,9-10H,4-6H2,1-3H3 |
| InChIKey | FWPQHUKROPLSJL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|