C10H12CuF12O4 — CID 5249777
copper;bis(1,1,1,5,5,5-hexafluoropentane-2,4-diol) (PubChem CID 5249777) has the molecular formula C10H12CuF12O4 and a molecular weight of 487.72 g/mol. Its IUPAC name is copper;bis(1,1,1,5,5,5-hexafluoropentane-2,4-diol).
| Compound Name | copper;bis(1,1,1,5,5,5-hexafluoropentane-2,4-diol) |
|---|---|
| PubChem CID | 5249777 |
| Molecular Formula | C10H12CuF12O4 |
| Molecular Weight | 487.72 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | copper;bis(1,1,1,5,5,5-hexafluoropentane-2,4-diol) |
| SMILES | OC(CC(O)C(F)(F)F)C(F)(F)F.OC(CC(O)C(F)(F)F)C(F)(F)F.[Cu] |
| InChI | InChI=1S/2C5H6F6O2.Cu/c2*6-4(7,8)2(12)1-3(13)5(9,10)11;/h2*2-3,12-13H,1H2; |
| InChIKey | JTFBUUVMFANEDV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.72 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |