C15H19F3N4O4 — CID 525000
6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2,2,2-trifluoroacetate (PubChem CID 525000) has the molecular formula C15H19F3N4O4 and a molecular weight of 376.34 g/mol. Its IUPAC name is 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2,2,2-trifluoroacetate.
| Compound Name | 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 525000 |
| Molecular Formula | C15H19F3N4O4 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2,2,2-trifluoroacetate |
| SMILES | CC(CCCCn1c(=O)c2c(ncn2C)n(C)c1=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N4O4/c1-9(26-13(24)15(16,17)18)6-4-5-7-22-12(23)10-11(19-8-20(10)2)21(3)14(22)25/h8-9H,4-7H2,1-3H3 |
| InChIKey | ZQNQBJNITRBVFR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|