C32H40N4O4Si4 — CID 5250163
7,7,15,15-tetramethyl-1,4,10,13-tetraphenyl-6,8,14,16-tetraoxa-1,4,10,13-tetraza-5,7,9,15-tetrasiladispiro[4.3.49.35]hexadecane (PubChem CID 5250163) has the molecular formula C32H40N4O4Si4 and a molecular weight of 657.04 g/mol. Its IUPAC name is 7,7,15,15-tetramethyl-1,4,10,13-tetraphenyl-6,8,14,16-tetraoxa-1,4,10,13-tetraza-5,7,9,15-tetrasiladispiro[4.3.49.35]hexadecane.
| Compound Name | 7,7,15,15-tetramethyl-1,4,10,13-tetraphenyl-6,8,14,16-tetraoxa-1,4,10,13-tetraza-5,7,9,15-tetrasiladispiro[4.3.49.35]hexadecane |
|---|---|
| PubChem CID | 5250163 |
| Molecular Formula | C32H40N4O4Si4 |
| Molecular Weight | 657.04 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | 7,7,15,15-tetramethyl-1,4,10,13-tetraphenyl-6,8,14,16-tetraoxa-1,4,10,13-tetraza-5,7,9,15-tetrasiladispiro[4.3.49.35]hexadecane |
| SMILES | C[Si]1(C)O[Si]2(O[Si](C)(C)O[Si]3(O1)N(c1ccccc1)CCN3c1ccccc1)N(c1ccccc1)CCN2c1ccccc1 |
| InChI | InChI=1S/C32H40N4O4Si4/c1-41(2)37-43(33(29-17-9-5-10-18-29)25-26-34(43)30-19-11-6-12-20-30)39-42(3,4)40-44(38-41)35(31-21-13-7-14-22-31)27-28-36(44)32-23-15-8-16-24-32/h5-24H,25-28H2,1-4H3 |
| InChIKey | HUSZINARNTYSIQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.04 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|