C22H20FN7O3 — CID 52503110
3-(3-fluorophenyl)-5-[(3R)-1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperidin-3-yl]-1,2,4-oxadiazole (PubChem CID 52503110) has the molecular formula C22H20FN7O3 and a molecular weight of 449.45 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5-[(3R)-1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(3-fluorophenyl)-5-[(3R)-1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 52503110 |
| Molecular Formula | C22H20FN7O3 |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-(3-fluorophenyl)-5-[(3R)-1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]piperidin-3-yl]-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2ncn(CN3CCC[C@@H](c4nc(-c5cccc(F)c5)no4)C3)n2)cc1 |
| InChI | InChI=1S/C22H20FN7O3/c23-18-5-1-3-16(11-18)21-25-22(33-27-21)17-4-2-10-28(12-17)14-29-13-24-20(26-29)15-6-8-19(9-7-15)30(31)32/h1,3,5-9,11,13,17H,2,4,10,12,14H2/t17-/m1/s1 |
| InChIKey | ICXKTDGZXGQMGA-QGZVFWFLSA-N |
| XLogP | 3.88 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|