C32H52AgN4-4 — CID 5250321
5,10-dicyclohexyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20-icosahydroporphyrin-21,22,23,24-tetraide;silver (PubChem CID 5250321) has the molecular formula C32H52AgN4-4 and a molecular weight of 600.66 g/mol. Its IUPAC name is 5,10-dicyclohexyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20-icosahydroporphyrin-21,22,23,24-tetraide;silver.
| Compound Name | 5,10-dicyclohexyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20-icosahydroporphyrin-21,22,23,24-tetraide;silver |
|---|---|
| PubChem CID | 5250321 |
| Molecular Formula | C32H52AgN4-4 |
| Molecular Weight | 600.66 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | 5,10-dicyclohexyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20-icosahydroporphyrin-21,22,23,24-tetraide;silver |
| SMILES | C1CCC(C2C3CCC(CC4CCC(CC5CCC([N-]5)C(C5CCCCC5)C5CCC2[N-]5)[N-]4)[N-]3)CC1.[Ag] |
| InChI | InChI=1S/C32H52N4.Ag/c1-3-7-21(8-4-1)31-27-15-13-25(34-27)19-23-11-12-24(33-23)20-26-14-16-28(35-26)32(22-9-5-2-6-10-22)30-18-17-29(31)36-30;/h21-32H,1-20H2;/q-4; |
| InChIKey | WHVXEROSCYLONZ-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.66 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |