C22H28O7 — CID 5250347
[4,4,13,13-tetramethyl-11-(3-methylbut-2-enyl)-6,10-dioxo-3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-en-9-yl] acetate (PubChem CID 5250347) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is [4,4,13,13-tetramethyl-11-(3-methylbut-2-enyl)-6,10-dioxo-3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-en-9-yl] acetate.
| Compound Name | [4,4,13,13-tetramethyl-11-(3-methylbut-2-enyl)-6,10-dioxo-3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-en-9-yl] acetate |
|---|---|
| PubChem CID | 5250347 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [4,4,13,13-tetramethyl-11-(3-methylbut-2-enyl)-6,10-dioxo-3,5,12-trioxatetracyclo[7.4.1.02,7.02,11]tetradec-7-en-9-yl] acetate |
| SMILES | CC(=O)OC12C=C3C(=O)OC(C)(C)OC34C(C1)C(C)(C)OC4(CC=C(C)C)C2=O |
| InChI | InChI=1S/C22H28O7/c1-12(2)8-9-21-17(25)20(26-13(3)23)10-14-16(24)27-19(6,7)29-22(14,21)15(11-20)18(4,5)28-21/h8,10,15H,9,11H2,1-7H3 |
| InChIKey | VYHHQARXVIKSOY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|