About 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine
2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine (PubChem CID 52504091) has the molecular formula C13H24N4S
and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine.
Molecular Properties
| Compound Name | 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine |
| PubChem CID | 52504091 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine |
| SMILES | CCNC(=NC[C@@H](c1cccs1)N(C)C)NCC |
| InChI | InChI=1S/C13H24N4S/c1-5-14-13(15-6-2)16-10-11(17(3)4)12-8-7-9-18-12/h7-9,11H,5-6,10H2,1-4H3,(H2,14,15,16)/t11-/m0/s1 |
| InChIKey | DAIATYQGLZSONG-NSHDSACASA-N |
| XLogP | 1.93 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine?
The IUPAC name of 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine (CID 52504091) is 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine.
What is the SMILES notation for 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine?
The canonical SMILES for 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine is CCNC(=NC[C@@H](c1cccs1)N(C)C)NCC.
What is the InChIKey of 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine?
The InChIKey is DAIATYQGLZSONG-NSHDSACASA-N. The full InChI is InChI=1S/C13H24N4S/c1-5-14-13(15-6-2)16-10-11(17(3)4)12-8-7-9-18-12/h7-9,11H,5-6,10H2,1-4H3,(H2,14,15,16)/t11-/m0/s1.
What are the key properties of 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine?
2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine has a molecular weight of 268.43 g/mol, XLogP of 1.93, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]-1,3-diethylguanidine is sourced from PubChem (CID 52504091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).