C24H62O6Si6 — CID 525043
trimethyl-[(2S,3S,4S,5S)-1,2,4,5,6-pentakis(trimethylsilyloxy)hexan-3-yl]oxysilane (PubChem CID 525043) has the molecular formula C24H62O6Si6 and a molecular weight of 615.27 g/mol. Its IUPAC name is trimethyl-[(2S,3S,4S,5S)-1,2,4,5,6-pentakis(trimethylsilyloxy)hexan-3-yl]oxysilane.
| Compound Name | trimethyl-[(2S,3S,4S,5S)-1,2,4,5,6-pentakis(trimethylsilyloxy)hexan-3-yl]oxysilane |
|---|---|
| PubChem CID | 525043 |
| Molecular Formula | C24H62O6Si6 |
| Molecular Weight | 615.27 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | trimethyl-[(2S,3S,4S,5S)-1,2,4,5,6-pentakis(trimethylsilyloxy)hexan-3-yl]oxysilane |
| SMILES | C[Si](C)(C)OC[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H62O6Si6/c1-31(2,3)25-19-21(27-33(7,8)9)23(29-35(13,14)15)24(30-36(16,17)18)22(28-34(10,11)12)20-26-32(4,5)6/h21-24H,19-20H2,1-18H3/t21-,22-,23-,24-/m0/s1 |
| InChIKey | USBJDBWAPKNPCK-ZJZGAYNASA-N |
| XLogP | 7.57 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.27 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|