C22H52O6Si5 — CID 525046
trimethylsilyl 1,3,4,5-tetrakis(trimethylsilyloxy)cyclohexane-1-carboxylate (PubChem CID 525046) has the molecular formula C22H52O6Si5 and a molecular weight of 553.08 g/mol. Its IUPAC name is trimethylsilyl 1,3,4,5-tetrakis(trimethylsilyloxy)cyclohexane-1-carboxylate.
| Compound Name | trimethylsilyl 1,3,4,5-tetrakis(trimethylsilyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 525046 |
| Molecular Formula | C22H52O6Si5 |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | trimethylsilyl 1,3,4,5-tetrakis(trimethylsilyloxy)cyclohexane-1-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C22H52O6Si5/c1-29(2,3)24-18-16-22(28-33(13,14)15,21(23)27-32(10,11)12)17-19(25-30(4,5)6)20(18)26-31(7,8)9/h18-20H,16-17H2,1-15H3 |
| InChIKey | DBCLHKSGLLGXOV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|