C49H56Cl2N4Ru-2 — CID 5250695
benzylidene(dichloro)ruthenium;bis(1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide) (PubChem CID 5250695) has the molecular formula C49H56Cl2N4Ru-2 and a molecular weight of 872.99 g/mol. Its IUPAC name is benzylidene(dichloro)ruthenium;bis(1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide).
| Compound Name | benzylidene(dichloro)ruthenium;bis(1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide) |
|---|---|
| PubChem CID | 5250695 |
| Molecular Formula | C49H56Cl2N4Ru-2 |
| Molecular Weight | 872.99 g/mol |
| Exact Mass | 872.29 |
| IUPAC Name | benzylidene(dichloro)ruthenium;bis(1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide) |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)[CH-]2)c(C)c1.Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)[CH-]2)c(C)c1.Cl[Ru](Cl)=Cc1ccccc1 |
| InChI | InChI=1S/2C21H25N2.C7H6.2ClH.Ru/c2*1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-7-5-3-2-4-6-7;;;/h2*7-13H,1-6H3;1-6H;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | ZIUWUQAJUAEHAH-UHFFFAOYSA-L |
| XLogP | 13.67 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.99 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|