About 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol
2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol (PubChem CID 5250799) has the molecular formula C10H16O3S2
and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol.
Molecular Properties
| Compound Name | 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol |
| PubChem CID | 5250799 |
| Molecular Formula | C10H16O3S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol |
| SMILES | CC1(C2CC(O)C=CO2)SCCCS1=O |
| InChI | InChI=1S/C10H16O3S2/c1-10(14-5-2-6-15(10)12)9-7-8(11)3-4-13-9/h3-4,8-9,11H,2,5-7H2,1H3 |
| InChIKey | NZTACNHPVCEMEW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol?
The IUPAC name of 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol (CID 5250799) is 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol.
What is the SMILES notation for 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol?
The canonical SMILES for 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol is CC1(C2CC(O)C=CO2)SCCCS1=O.
What is the InChIKey of 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol?
The InChIKey is NZTACNHPVCEMEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3S2/c1-10(14-5-2-6-15(10)12)9-7-8(11)3-4-13-9/h3-4,8-9,11H,2,5-7H2,1H3.
What are the key properties of 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol?
2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol has a molecular weight of 248.37 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1-oxo-1,3-dithian-2-yl)-3,4-dihydro-2H-pyran-4-ol is sourced from PubChem (CID 5250799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).