C12H11Cl3O6 — CID 5250870
1,7,8-trichloro-9,10,10-trimethoxy-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 5250870) has the molecular formula C12H11Cl3O6 and a molecular weight of 357.57 g/mol. Its IUPAC name is 1,7,8-trichloro-9,10,10-trimethoxy-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1,7,8-trichloro-9,10,10-trimethoxy-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 5250870 |
| Molecular Formula | C12H11Cl3O6 |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 1,7,8-trichloro-9,10,10-trimethoxy-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COC1=C(Cl)C2(Cl)C3C(=O)OC(=O)C3C1(Cl)C2(OC)OC |
| InChI | InChI=1S/C12H11Cl3O6/c1-18-7-6(13)10(14)4-5(9(17)21-8(4)16)11(7,15)12(10,19-2)20-3/h4-5H,1-3H3 |
| InChIKey | YUMYXFKEQZAOBA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|